C16H23NO2 — CID 114493908
1-(2-ethyl-2-hydroxybutyl)-3,4-dihydro-2H-1-benzazepin-5-one (PubChem CID 114493908) has the molecular formula C16H23NO2 and a molecular weight of 261.36 g/mol. Its IUPAC name is 1-(2-ethyl-2-hydroxybutyl)-3,4-dihydro-2H-1-benzazepin-5-one.
| Compound Name | 1-(2-ethyl-2-hydroxybutyl)-3,4-dihydro-2H-1-benzazepin-5-one |
|---|---|
| PubChem CID | 114493908 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.36 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | 1-(2-ethyl-2-hydroxybutyl)-3,4-dihydro-2H-1-benzazepin-5-one |
| SMILES | CCC(O)(CC)CN1CCCC(=O)c2ccccc21 |
| InChI | InChI=1S/C16H23NO2/c1-3-16(19,4-2)12-17-11-7-10-15(18)13-8-5-6-9-14(13)17/h5-6,8-9,19H,3-4,7,10-12H2,1-2H3 |
| InChIKey | SUNIRFICDYBCPI-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.36 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |