C13H21N3O2S — CID 28783515
6-amino-N,N-diethyl-3,4-dihydro-2H-quinoline-1-sulfonamide (PubChem CID 28783515) has the molecular formula C13H21N3O2S and a molecular weight of 283.40 g/mol. Its IUPAC name is 6-amino-N,N-diethyl-3,4-dihydro-2H-quinoline-1-sulfonamide.
| Compound Name | 6-amino-N,N-diethyl-3,4-dihydro-2H-quinoline-1-sulfonamide |
|---|---|
| PubChem CID | 28783515 |
| Molecular Formula | C13H21N3O2S |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 6-amino-N,N-diethyl-3,4-dihydro-2H-quinoline-1-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)N1CCCc2cc(N)ccc21 |
| InChI | InChI=1S/C13H21N3O2S/c1-3-15(4-2)19(17,18)16-9-5-6-11-10-12(14)7-8-13(11)16/h7-8,10H,3-6,9,14H2,1-2H3 |
| InChIKey | DXPGXHNHWVLONX-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|