C11H17N3O2S — CID 28707191
7-amino-N,N-dimethyl-3,4-dihydro-2H-quinoline-1-sulfonamide (PubChem CID 28707191) has the molecular formula C11H17N3O2S and a molecular weight of 255.34 g/mol. Its IUPAC name is 7-amino-N,N-dimethyl-3,4-dihydro-2H-quinoline-1-sulfonamide.
| Compound Name | 7-amino-N,N-dimethyl-3,4-dihydro-2H-quinoline-1-sulfonamide |
|---|---|
| PubChem CID | 28707191 |
| Molecular Formula | C11H17N3O2S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 7-amino-N,N-dimethyl-3,4-dihydro-2H-quinoline-1-sulfonamide |
| SMILES | CN(C)S(=O)(=O)N1CCCc2ccc(N)cc21 |
| InChI | InChI=1S/C11H17N3O2S/c1-13(2)17(15,16)14-7-3-4-9-5-6-10(12)8-11(9)14/h5-6,8H,3-4,7,12H2,1-2H3 |
| InChIKey | WIGJLATVAYYGRC-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|