C15H15ClN2O2S — CID 62266376
1-(3-chlorophenyl)sulfonyl-3,4-dihydro-2H-quinolin-7-amine (PubChem CID 62266376) has the molecular formula C15H15ClN2O2S and a molecular weight of 322.82 g/mol. Its IUPAC name is 1-(3-chlorophenyl)sulfonyl-3,4-dihydro-2H-quinolin-7-amine.
| Compound Name | 1-(3-chlorophenyl)sulfonyl-3,4-dihydro-2H-quinolin-7-amine |
|---|---|
| PubChem CID | 62266376 |
| Molecular Formula | C15H15ClN2O2S |
| Molecular Weight | 322.82 g/mol |
| Exact Mass | 322.05 |
| IUPAC Name | 1-(3-chlorophenyl)sulfonyl-3,4-dihydro-2H-quinolin-7-amine |
| SMILES | Nc1ccc2c(c1)N(S(=O)(=O)c1cccc(Cl)c1)CCC2 |
| InChI | InChI=1S/C15H15ClN2O2S/c16-12-4-1-5-14(9-12)21(19,20)18-8-2-3-11-6-7-13(17)10-15(11)18/h1,4-7,9-10H,2-3,8,17H2 |
| InChIKey | RRKLXWITAHUWAO-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.82 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|