C14H14N2O2S — CID 16642564
1-(benzenesulfonyl)-2,3-dihydroindol-5-amine (PubChem CID 16642564) has the molecular formula C14H14N2O2S and a molecular weight of 274.35 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-2,3-dihydroindol-5-amine.
| Compound Name | 1-(benzenesulfonyl)-2,3-dihydroindol-5-amine |
|---|---|
| PubChem CID | 16642564 |
| Molecular Formula | C14H14N2O2S |
| Molecular Weight | 274.35 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 1-(benzenesulfonyl)-2,3-dihydroindol-5-amine |
| SMILES | Nc1ccc2c(c1)CCN2S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C14H14N2O2S/c15-12-6-7-14-11(10-12)8-9-16(14)19(17,18)13-4-2-1-3-5-13/h1-7,10H,8-9,15H2 |
| InChIKey | HGEROBBDRJQFIQ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.35 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|