C19H23N3O2S — CID 155552356
1-(benzenesulfonyl)-5-(4-methylpiperazin-1-yl)-2,3-dihydroindole (PubChem CID 155552356) has the molecular formula C19H23N3O2S and a molecular weight of 357.48 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-5-(4-methylpiperazin-1-yl)-2,3-dihydroindole.
| Compound Name | 1-(benzenesulfonyl)-5-(4-methylpiperazin-1-yl)-2,3-dihydroindole |
|---|---|
| PubChem CID | 155552356 |
| Molecular Formula | C19H23N3O2S |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | 1-(benzenesulfonyl)-5-(4-methylpiperazin-1-yl)-2,3-dihydroindole |
| SMILES | CN1CCN(c2ccc3c(c2)CCN3S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C19H23N3O2S/c1-20-11-13-21(14-12-20)17-7-8-19-16(15-17)9-10-22(19)25(23,24)18-5-3-2-4-6-18/h2-8,15H,9-14H2,1H3 |
| InChIKey | JGVZGPYSWWXYDX-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|