C15H15NO2S — CID 110713907
1-(benzenesulfonyl)-5-methyl-2,3-dihydroindole (PubChem CID 110713907) has the molecular formula C15H15NO2S and a molecular weight of 273.36 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-5-methyl-2,3-dihydroindole.
| Compound Name | 1-(benzenesulfonyl)-5-methyl-2,3-dihydroindole |
|---|---|
| PubChem CID | 110713907 |
| Molecular Formula | C15H15NO2S |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 1-(benzenesulfonyl)-5-methyl-2,3-dihydroindole |
| SMILES | Cc1ccc2c(c1)CCN2S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C15H15NO2S/c1-12-7-8-15-13(11-12)9-10-16(15)19(17,18)14-5-3-2-4-6-14/h2-8,11H,9-10H2,1H3 |
| InChIKey | RVWMJXSTNXFLDG-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |