C15H15NO3S — CID 10779793
1-(4-methylphenyl)sulfonyl-2,3-dihydroindol-5-ol (PubChem CID 10779793) has the molecular formula C15H15NO3S and a molecular weight of 289.36 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfonyl-2,3-dihydroindol-5-ol.
| Compound Name | 1-(4-methylphenyl)sulfonyl-2,3-dihydroindol-5-ol |
|---|---|
| PubChem CID | 10779793 |
| Molecular Formula | C15H15NO3S |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | 1-(4-methylphenyl)sulfonyl-2,3-dihydroindol-5-ol |
| SMILES | Cc1ccc(S(=O)(=O)N2CCc3cc(O)ccc32)cc1 |
| InChI | InChI=1S/C15H15NO3S/c1-11-2-5-14(6-3-11)20(18,19)16-9-8-12-10-13(17)4-7-15(12)16/h2-7,10,17H,8-9H2,1H3 |
| InChIKey | ZEYKEWJLFTZGAM-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |