C16H16N2O5S — CID 59442060
5-methoxy-1-(4-methylphenyl)sulfonyl-6-nitro-2,3-dihydroindole (PubChem CID 59442060) has the molecular formula C16H16N2O5S and a molecular weight of 348.38 g/mol. Its IUPAC name is 5-methoxy-1-(4-methylphenyl)sulfonyl-6-nitro-2,3-dihydroindole.
| Compound Name | 5-methoxy-1-(4-methylphenyl)sulfonyl-6-nitro-2,3-dihydroindole |
|---|---|
| PubChem CID | 59442060 |
| Molecular Formula | C16H16N2O5S |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | 5-methoxy-1-(4-methylphenyl)sulfonyl-6-nitro-2,3-dihydroindole |
| SMILES | COc1cc2c(cc1[N+](=O)[O-])N(S(=O)(=O)c1ccc(C)cc1)CC2 |
| InChI | InChI=1S/C16H16N2O5S/c1-11-3-5-13(6-4-11)24(21,22)17-8-7-12-9-16(23-2)15(18(19)20)10-14(12)17/h3-6,9-10H,7-8H2,1-2H3 |
| InChIKey | LHSSBMFCDRSCSN-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|