C16H14N2O2S — CID 71134780
1-(4-methylphenyl)sulfonyl-2,3-dihydroindole-5-carbonitrile (PubChem CID 71134780) has the molecular formula C16H14N2O2S and a molecular weight of 298.37 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfonyl-2,3-dihydroindole-5-carbonitrile.
| Compound Name | 1-(4-methylphenyl)sulfonyl-2,3-dihydroindole-5-carbonitrile |
|---|---|
| PubChem CID | 71134780 |
| Molecular Formula | C16H14N2O2S |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 1-(4-methylphenyl)sulfonyl-2,3-dihydroindole-5-carbonitrile |
| SMILES | Cc1ccc(S(=O)(=O)N2CCc3cc(C#N)ccc32)cc1 |
| InChI | InChI=1S/C16H14N2O2S/c1-12-2-5-15(6-3-12)21(19,20)18-9-8-14-10-13(11-17)4-7-16(14)18/h2-7,10H,8-9H2,1H3 |
| InChIKey | SACOGGNGOWCZDW-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |