C22H22N2O2S — CID 44512508
2,2,3-trimethyl-7-(4-methylphenyl)sulfonyl-7-azatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-11-carbonitrile (PubChem CID 44512508) has the molecular formula C22H22N2O2S and a molecular weight of 378.50 g/mol. Its IUPAC name is 2,2,3-trimethyl-7-(4-methylphenyl)sulfonyl-7-azatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-11-carbonitrile.
| Compound Name | 2,2,3-trimethyl-7-(4-methylphenyl)sulfonyl-7-azatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-11-carbonitrile |
|---|---|
| PubChem CID | 44512508 |
| Molecular Formula | C22H22N2O2S |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | 2,2,3-trimethyl-7-(4-methylphenyl)sulfonyl-7-azatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-11-carbonitrile |
| SMILES | CC1=C2CCN(S(=O)(=O)c3ccc(C)cc3)c3ccc(C#N)c(c32)C1(C)C |
| InChI | InChI=1S/C22H22N2O2S/c1-14-5-8-17(9-6-14)27(25,26)24-12-11-18-15(2)22(3,4)21-16(13-23)7-10-19(24)20(18)21/h5-10H,11-12H2,1-4H3 |
| InChIKey | QDOUIFFAQWFOJQ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |