C23H18N2O2S2 — CID 71604782
1-(4-methylphenyl)sulfonyl-4-phenylsulfanyl-2H-quinoline-6-carbonitrile (PubChem CID 71604782) has the molecular formula C23H18N2O2S2 and a molecular weight of 418.54 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfonyl-4-phenylsulfanyl-2H-quinoline-6-carbonitrile.
| Compound Name | 1-(4-methylphenyl)sulfonyl-4-phenylsulfanyl-2H-quinoline-6-carbonitrile |
|---|---|
| PubChem CID | 71604782 |
| Molecular Formula | C23H18N2O2S2 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | 1-(4-methylphenyl)sulfonyl-4-phenylsulfanyl-2H-quinoline-6-carbonitrile |
| SMILES | Cc1ccc(S(=O)(=O)N2CC=C(Sc3ccccc3)c3cc(C#N)ccc32)cc1 |
| InChI | InChI=1S/C23H18N2O2S2/c1-17-7-10-20(11-8-17)29(26,27)25-14-13-23(28-19-5-3-2-4-6-19)21-15-18(16-24)9-12-22(21)25/h2-13,15H,14H2,1H3 |
| InChIKey | FZZQQSODZATJDG-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |