About 2-(4-methylphenyl)sulfonyl-5,6-diphenyl-1,3-dihydroisoindole
2-(4-methylphenyl)sulfonyl-5,6-diphenyl-1,3-dihydroisoindole (PubChem CID 134951286) has the molecular formula C27H23NO2S
and a molecular weight of 425.55 g/mol. Its IUPAC name is 2-(4-methylphenyl)sulfonyl-5,6-diphenyl-1,3-dihydroisoindole.
Molecular Properties
| Compound Name | 2-(4-methylphenyl)sulfonyl-5,6-diphenyl-1,3-dihydroisoindole |
| PubChem CID | 134951286 |
| Molecular Formula | C27H23NO2S |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | 2-(4-methylphenyl)sulfonyl-5,6-diphenyl-1,3-dihydroisoindole |
| SMILES | Cc1ccc(S(=O)(=O)N2Cc3cc(-c4ccccc4)c(-c4ccccc4)cc3C2)cc1 |
| InChI | InChI=1S/C27H23NO2S/c1-20-12-14-25(15-13-20)31(29,30)28-18-23-16-26(21-8-4-2-5-9-21)27(17-24(23)19-28)22-10-6-3-7-11-22/h2-17H,18-19H2,1H3 |
| InChIKey | GMNYPKCOUDWCBA-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(4-methylphenyl)sulfonyl-5,6-diphenyl-1,3-dihydroisoindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methylphenyl)sulfonyl-5,6-diphenyl-1,3-dihydroisoindole?
The IUPAC name of 2-(4-methylphenyl)sulfonyl-5,6-diphenyl-1,3-dihydroisoindole (CID 134951286) is 2-(4-methylphenyl)sulfonyl-5,6-diphenyl-1,3-dihydroisoindole.
What is the SMILES notation for 2-(4-methylphenyl)sulfonyl-5,6-diphenyl-1,3-dihydroisoindole?
The canonical SMILES for 2-(4-methylphenyl)sulfonyl-5,6-diphenyl-1,3-dihydroisoindole is Cc1ccc(S(=O)(=O)N2Cc3cc(-c4ccccc4)c(-c4ccccc4)cc3C2)cc1.
What is the InChIKey of 2-(4-methylphenyl)sulfonyl-5,6-diphenyl-1,3-dihydroisoindole?
The InChIKey is GMNYPKCOUDWCBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H23NO2S/c1-20-12-14-25(15-13-20)31(29,30)28-18-23-16-26(21-8-4-2-5-9-21)27(17-24(23)19-28)22-10-6-3-7-11-22/h2-17H,18-19H2,1H3.
What are the key properties of 2-(4-methylphenyl)sulfonyl-5,6-diphenyl-1,3-dihydroisoindole?
2-(4-methylphenyl)sulfonyl-5,6-diphenyl-1,3-dihydroisoindole has a molecular weight of 425.55 g/mol, XLogP of 6.03, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methylphenyl)sulfonyl-5,6-diphenyl-1,3-dihydroisoindole is sourced from PubChem (CID 134951286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).