C27H23NO2S — CID 134951286
2-(4-methylphenyl)sulfonyl-5,6-diphenyl-1,3-dihydroisoindole (PubChem CID 134951286) has the molecular formula C27H23NO2S and a molecular weight of 425.55 g/mol. Its IUPAC name is 2-(4-methylphenyl)sulfonyl-5,6-diphenyl-1,3-dihydroisoindole.
| Compound Name | 2-(4-methylphenyl)sulfonyl-5,6-diphenyl-1,3-dihydroisoindole |
|---|---|
| PubChem CID | 134951286 |
| Molecular Formula | C27H23NO2S |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | 2-(4-methylphenyl)sulfonyl-5,6-diphenyl-1,3-dihydroisoindole |
| SMILES | Cc1ccc(S(=O)(=O)N2Cc3cc(-c4ccccc4)c(-c4ccccc4)cc3C2)cc1 |
| InChI | InChI=1S/C27H23NO2S/c1-20-12-14-25(15-13-20)31(29,30)28-18-23-16-26(21-8-4-2-5-9-21)27(17-24(23)19-28)22-10-6-3-7-11-22/h2-17H,18-19H2,1H3 |
| InChIKey | GMNYPKCOUDWCBA-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |