C25H21NO3S — CID 132990624
5-(4-methylphenyl)sulfonyl-1,3-diphenyl-4,6-dihydrofuro[3,4-c]pyrrole (PubChem CID 132990624) has the molecular formula C25H21NO3S and a molecular weight of 415.51 g/mol. Its IUPAC name is 5-(4-methylphenyl)sulfonyl-1,3-diphenyl-4,6-dihydrofuro[3,4-c]pyrrole.
| Compound Name | 5-(4-methylphenyl)sulfonyl-1,3-diphenyl-4,6-dihydrofuro[3,4-c]pyrrole |
|---|---|
| PubChem CID | 132990624 |
| Molecular Formula | C25H21NO3S |
| Molecular Weight | 415.51 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | 5-(4-methylphenyl)sulfonyl-1,3-diphenyl-4,6-dihydrofuro[3,4-c]pyrrole |
| SMILES | Cc1ccc(S(=O)(=O)N2Cc3c(-c4ccccc4)oc(-c4ccccc4)c3C2)cc1 |
| InChI | InChI=1S/C25H21NO3S/c1-18-12-14-21(15-13-18)30(27,28)26-16-22-23(17-26)25(20-10-6-3-7-11-20)29-24(22)19-8-4-2-5-9-19/h2-15H,16-17H2,1H3 |
| InChIKey | IBYUAQHWVHGAFZ-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.51 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |