C16H20INO3SSi — CID 122203613
[3-iodo-5-(4-methylphenyl)sulfonyl-4,6-dihydrofuro[3,4-c]pyrrol-1-yl]-trimethylsilane (PubChem CID 122203613) has the molecular formula C16H20INO3SSi and a molecular weight of 461.40 g/mol. Its IUPAC name is [3-iodo-5-(4-methylphenyl)sulfonyl-4,6-dihydrofuro[3,4-c]pyrrol-1-yl]-trimethylsilane.
| Compound Name | [3-iodo-5-(4-methylphenyl)sulfonyl-4,6-dihydrofuro[3,4-c]pyrrol-1-yl]-trimethylsilane |
|---|---|
| PubChem CID | 122203613 |
| Molecular Formula | C16H20INO3SSi |
| Molecular Weight | 461.40 g/mol |
| Exact Mass | 461.00 |
| IUPAC Name | [3-iodo-5-(4-methylphenyl)sulfonyl-4,6-dihydrofuro[3,4-c]pyrrol-1-yl]-trimethylsilane |
| SMILES | Cc1ccc(S(=O)(=O)N2Cc3c(I)oc([Si](C)(C)C)c3C2)cc1 |
| InChI | InChI=1S/C16H20INO3SSi/c1-11-5-7-12(8-6-11)22(19,20)18-9-13-14(10-18)16(21-15(13)17)23(2,3)4/h5-8H,9-10H2,1-4H3 |
| InChIKey | CHBBQDKBVPLITF-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.40 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|