C16H17NO3S — CID 11289669
5-methyl-2-(4-methylphenyl)sulfonyl-1,3-dihydroisoindol-4-ol (PubChem CID 11289669) has the molecular formula C16H17NO3S and a molecular weight of 303.38 g/mol. Its IUPAC name is 5-methyl-2-(4-methylphenyl)sulfonyl-1,3-dihydroisoindol-4-ol.
| Compound Name | 5-methyl-2-(4-methylphenyl)sulfonyl-1,3-dihydroisoindol-4-ol |
|---|---|
| PubChem CID | 11289669 |
| Molecular Formula | C16H17NO3S |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 5-methyl-2-(4-methylphenyl)sulfonyl-1,3-dihydroisoindol-4-ol |
| SMILES | Cc1ccc(S(=O)(=O)N2Cc3ccc(C)c(O)c3C2)cc1 |
| InChI | InChI=1S/C16H17NO3S/c1-11-3-7-14(8-4-11)21(19,20)17-9-13-6-5-12(2)16(18)15(13)10-17/h3-8,18H,9-10H2,1-2H3 |
| InChIKey | WZNJPAOMJUBGMW-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|