C24H25NO4S — CID 101418366
5-(4-methoxy-2,6-dimethylphenyl)-2-(4-methylphenyl)sulfonyl-1,3-dihydroisoindol-4-ol (PubChem CID 101418366) has the molecular formula C24H25NO4S and a molecular weight of 423.53 g/mol. Its IUPAC name is 5-(4-methoxy-2,6-dimethylphenyl)-2-(4-methylphenyl)sulfonyl-1,3-dihydroisoindol-4-ol.
| Compound Name | 5-(4-methoxy-2,6-dimethylphenyl)-2-(4-methylphenyl)sulfonyl-1,3-dihydroisoindol-4-ol |
|---|---|
| PubChem CID | 101418366 |
| Molecular Formula | C24H25NO4S |
| Molecular Weight | 423.53 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | 5-(4-methoxy-2,6-dimethylphenyl)-2-(4-methylphenyl)sulfonyl-1,3-dihydroisoindol-4-ol |
| SMILES | COc1cc(C)c(-c2ccc3c(c2O)CN(S(=O)(=O)c2ccc(C)cc2)C3)c(C)c1 |
| InChI | InChI=1S/C24H25NO4S/c1-15-5-8-20(9-6-15)30(27,28)25-13-18-7-10-21(24(26)22(18)14-25)23-16(2)11-19(29-4)12-17(23)3/h5-12,26H,13-14H2,1-4H3 |
| InChIKey | ZZHANRDGZSBPHE-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.53 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|