C17H19NO3S — CID 25259017
4,7-dimethyl-2-(4-methylphenyl)sulfonyl-1,3-dihydroisoindol-5-ol (PubChem CID 25259017) has the molecular formula C17H19NO3S and a molecular weight of 317.41 g/mol. Its IUPAC name is 4,7-dimethyl-2-(4-methylphenyl)sulfonyl-1,3-dihydroisoindol-5-ol.
| Compound Name | 4,7-dimethyl-2-(4-methylphenyl)sulfonyl-1,3-dihydroisoindol-5-ol |
|---|---|
| PubChem CID | 25259017 |
| Molecular Formula | C17H19NO3S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | 4,7-dimethyl-2-(4-methylphenyl)sulfonyl-1,3-dihydroisoindol-5-ol |
| SMILES | Cc1ccc(S(=O)(=O)N2Cc3c(C)cc(O)c(C)c3C2)cc1 |
| InChI | InChI=1S/C17H19NO3S/c1-11-4-6-14(7-5-11)22(20,21)18-9-15-12(2)8-17(19)13(3)16(15)10-18/h4-8,19H,9-10H2,1-3H3 |
| InChIKey | FVIYGAARXVRVFV-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |