C18H23NO3SSi — CID 24756122
2-(4-methylphenyl)sulfonyl-5-trimethylsilyl-1,3-dihydroisoindol-4-ol (PubChem CID 24756122) has the molecular formula C18H23NO3SSi and a molecular weight of 361.54 g/mol. Its IUPAC name is 2-(4-methylphenyl)sulfonyl-5-trimethylsilyl-1,3-dihydroisoindol-4-ol.
| Compound Name | 2-(4-methylphenyl)sulfonyl-5-trimethylsilyl-1,3-dihydroisoindol-4-ol |
|---|---|
| PubChem CID | 24756122 |
| Molecular Formula | C18H23NO3SSi |
| Molecular Weight | 361.54 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | 2-(4-methylphenyl)sulfonyl-5-trimethylsilyl-1,3-dihydroisoindol-4-ol |
| SMILES | Cc1ccc(S(=O)(=O)N2Cc3ccc([Si](C)(C)C)c(O)c3C2)cc1 |
| InChI | InChI=1S/C18H23NO3SSi/c1-13-5-8-15(9-6-13)23(21,22)19-11-14-7-10-17(24(2,3)4)18(20)16(14)12-19/h5-10,20H,11-12H2,1-4H3 |
| InChIKey | TYFCUUXQFRERBO-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.54 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|