C21H19NO2S — CID 11268113
2-(4-methylphenyl)sulfonyl-5-phenyl-1,3-dihydroisoindole (PubChem CID 11268113) has the molecular formula C21H19NO2S and a molecular weight of 349.46 g/mol. Its IUPAC name is 2-(4-methylphenyl)sulfonyl-5-phenyl-1,3-dihydroisoindole.
| Compound Name | 2-(4-methylphenyl)sulfonyl-5-phenyl-1,3-dihydroisoindole |
|---|---|
| PubChem CID | 11268113 |
| Molecular Formula | C21H19NO2S |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | 2-(4-methylphenyl)sulfonyl-5-phenyl-1,3-dihydroisoindole |
| SMILES | Cc1ccc(S(=O)(=O)N2Cc3ccc(-c4ccccc4)cc3C2)cc1 |
| InChI | InChI=1S/C21H19NO2S/c1-16-7-11-21(12-8-16)25(23,24)22-14-19-10-9-18(13-20(19)15-22)17-5-3-2-4-6-17/h2-13H,14-15H2,1H3 |
| InChIKey | LBZPGYBRKPGQIR-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |