C19H23NO2S — CID 10991122
5-butyl-2-(4-methylphenyl)sulfonyl-1,3-dihydroisoindole (PubChem CID 10991122) has the molecular formula C19H23NO2S and a molecular weight of 329.47 g/mol. Its IUPAC name is 5-butyl-2-(4-methylphenyl)sulfonyl-1,3-dihydroisoindole.
| Compound Name | 5-butyl-2-(4-methylphenyl)sulfonyl-1,3-dihydroisoindole |
|---|---|
| PubChem CID | 10991122 |
| Molecular Formula | C19H23NO2S |
| Molecular Weight | 329.47 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 5-butyl-2-(4-methylphenyl)sulfonyl-1,3-dihydroisoindole |
| SMILES | CCCCc1ccc2c(c1)CN(S(=O)(=O)c1ccc(C)cc1)C2 |
| InChI | InChI=1S/C19H23NO2S/c1-3-4-5-16-8-9-17-13-20(14-18(17)12-16)23(21,22)19-10-6-15(2)7-11-19/h6-12H,3-5,13-14H2,1-2H3 |
| InChIKey | GBXSJMOPHGGKTN-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.47 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |