C15H15ClN2O2S — CID 101384668
6-(chloromethyl)-2-(4-methylphenyl)sulfonyl-1,3-dihydropyrrolo[3,4-c]pyridine (PubChem CID 101384668) has the molecular formula C15H15ClN2O2S and a molecular weight of 322.82 g/mol. Its IUPAC name is 6-(chloromethyl)-2-(4-methylphenyl)sulfonyl-1,3-dihydropyrrolo[3,4-c]pyridine.
| Compound Name | 6-(chloromethyl)-2-(4-methylphenyl)sulfonyl-1,3-dihydropyrrolo[3,4-c]pyridine |
|---|---|
| PubChem CID | 101384668 |
| Molecular Formula | C15H15ClN2O2S |
| Molecular Weight | 322.82 g/mol |
| Exact Mass | 322.05 |
| IUPAC Name | 6-(chloromethyl)-2-(4-methylphenyl)sulfonyl-1,3-dihydropyrrolo[3,4-c]pyridine |
| SMILES | Cc1ccc(S(=O)(=O)N2Cc3cnc(CCl)cc3C2)cc1 |
| InChI | InChI=1S/C15H15ClN2O2S/c1-11-2-4-15(5-3-11)21(19,20)18-9-12-6-14(7-16)17-8-13(12)10-18/h2-6,8H,7,9-10H2,1H3 |
| InChIKey | DAOIUSUEKKJMBW-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.82 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|