C17H17Br2NO2S — CID 138981305
5,6-bis(bromomethyl)-2-(4-methylphenyl)sulfonyl-1,3-dihydroisoindole (PubChem CID 138981305) has the molecular formula C17H17Br2NO2S and a molecular weight of 459.20 g/mol. Its IUPAC name is 5,6-bis(bromomethyl)-2-(4-methylphenyl)sulfonyl-1,3-dihydroisoindole.
| Compound Name | 5,6-bis(bromomethyl)-2-(4-methylphenyl)sulfonyl-1,3-dihydroisoindole |
|---|---|
| PubChem CID | 138981305 |
| Molecular Formula | C17H17Br2NO2S |
| Molecular Weight | 459.20 g/mol |
| Exact Mass | 456.93 |
| IUPAC Name | 5,6-bis(bromomethyl)-2-(4-methylphenyl)sulfonyl-1,3-dihydroisoindole |
| SMILES | Cc1ccc(S(=O)(=O)N2Cc3cc(CBr)c(CBr)cc3C2)cc1 |
| InChI | InChI=1S/C17H17Br2NO2S/c1-12-2-4-17(5-3-12)23(21,22)20-10-15-6-13(8-18)14(9-19)7-16(15)11-20/h2-7H,8-11H2,1H3 |
| InChIKey | XDJFRLCODJDJSC-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.20 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|