C12H15Br2NO2S — CID 56776985
3,3-bis(bromomethyl)-1-(4-methylphenyl)sulfonylazetidine (PubChem CID 56776985) has the molecular formula C12H15Br2NO2S and a molecular weight of 397.13 g/mol. Its IUPAC name is 3,3-bis(bromomethyl)-1-(4-methylphenyl)sulfonylazetidine.
| Compound Name | 3,3-bis(bromomethyl)-1-(4-methylphenyl)sulfonylazetidine |
|---|---|
| PubChem CID | 56776985 |
| Molecular Formula | C12H15Br2NO2S |
| Molecular Weight | 397.13 g/mol |
| Exact Mass | 394.92 |
| IUPAC Name | 3,3-bis(bromomethyl)-1-(4-methylphenyl)sulfonylazetidine |
| SMILES | Cc1ccc(S(=O)(=O)N2CC(CBr)(CBr)C2)cc1 |
| InChI | InChI=1S/C12H15Br2NO2S/c1-10-2-4-11(5-3-10)18(16,17)15-8-12(6-13,7-14)9-15/h2-5H,6-9H2,1H3 |
| InChIKey | IOQDNRYTTAIWTH-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.13 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|