C38H34N2O4S2 — CID 132511082
(1R,5R,12S,16S)-3,14-bis-(4-methylphenyl)sulfonyl-3,14-diazaheptacyclo[14.6.2.25,12.01,5.06,11.012,16.017,22]hexacosa-6,8,10,17,19,21,23,25-octaene (PubChem CID 132511082) has the molecular formula C38H34N2O4S2 and a molecular weight of 646.83 g/mol. Its IUPAC name is (1R,5R,12S,16S)-3,14-bis-(4-methylphenyl)sulfonyl-3,14-diazaheptacyclo[14.6.2.25,12.01,5.06,11.012,16.017,22]hexacosa-6,8,10,17,19,21,23,25-octaene.
| Compound Name | (1R,5R,12S,16S)-3,14-bis-(4-methylphenyl)sulfonyl-3,14-diazaheptacyclo[14.6.2.25,12.01,5.06,11.012,16.017,22]hexacosa-6,8,10,17,19,21,23,25-octaene |
|---|---|
| PubChem CID | 132511082 |
| Molecular Formula | C38H34N2O4S2 |
| Molecular Weight | 646.83 g/mol |
| Exact Mass | 646.20 |
| IUPAC Name | (1R,5R,12S,16S)-3,14-bis-(4-methylphenyl)sulfonyl-3,14-diazaheptacyclo[14.6.2.25,12.01,5.06,11.012,16.017,22]hexacosa-6,8,10,17,19,21,23,25-octaene |
| SMILES | Cc1ccc(S(=O)(=O)N2C[C@]34C=C[C@@]5(CN(S(=O)(=O)c6ccc(C)cc6)C[C@@]56C=C[C@]3(C2)c2ccccc26)c2ccccc24)cc1 |
| InChI | InChI=1S/C38H34N2O4S2/c1-27-11-15-29(16-12-27)45(41,42)39-23-35-19-21-37(33-9-5-3-7-31(33)35)25-40(46(43,44)30-17-13-28(2)14-18-30)26-38(37)22-20-36(35,24-39)32-8-4-6-10-34(32)38/h3-22H,23-26H2,1-2H3/t35-,36-,37+,38+ |
| InChIKey | LTMVAOPERLYGPS-MYYWMFIASA-N |
| XLogP | 5.52 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.83 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|