C25H23NO2S — CID 101471695
6,7-dimethylidene-3-(4-methylphenyl)sulfonyl-1-naphthalen-1-yl-3-azabicyclo[3.1.1]heptane (PubChem CID 101471695) has the molecular formula C25H23NO2S and a molecular weight of 401.53 g/mol. Its IUPAC name is 6,7-dimethylidene-3-(4-methylphenyl)sulfonyl-1-naphthalen-1-yl-3-azabicyclo[3.1.1]heptane.
| Compound Name | 6,7-dimethylidene-3-(4-methylphenyl)sulfonyl-1-naphthalen-1-yl-3-azabicyclo[3.1.1]heptane |
|---|---|
| PubChem CID | 101471695 |
| Molecular Formula | C25H23NO2S |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | 6,7-dimethylidene-3-(4-methylphenyl)sulfonyl-1-naphthalen-1-yl-3-azabicyclo[3.1.1]heptane |
| SMILES | C=C1C2CN(S(=O)(=O)c3ccc(C)cc3)CC1(c1cccc3ccccc13)C2=C |
| InChI | InChI=1S/C25H23NO2S/c1-17-11-13-21(14-12-17)29(27,28)26-15-23-18(2)25(16-26,19(23)3)24-10-6-8-20-7-4-5-9-22(20)24/h4-14,23H,2-3,15-16H2,1H3 |
| InChIKey | AGIFNGQDKYKLCI-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|