C22H22NO2PS — CID 117064678
(1S,4S,5S)-2-(4-methylphenyl)sulfonyl-5-naphthalen-1-yl-2-aza-5-phosphabicyclo[2.2.1]heptane (PubChem CID 117064678) has the molecular formula C22H22NO2PS and a molecular weight of 395.46 g/mol. Its IUPAC name is (1S,4S,5S)-2-(4-methylphenyl)sulfonyl-5-naphthalen-1-yl-2-aza-5-phosphabicyclo[2.2.1]heptane.
| Compound Name | (1S,4S,5S)-2-(4-methylphenyl)sulfonyl-5-naphthalen-1-yl-2-aza-5-phosphabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 117064678 |
| Molecular Formula | C22H22NO2PS |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | (1S,4S,5S)-2-(4-methylphenyl)sulfonyl-5-naphthalen-1-yl-2-aza-5-phosphabicyclo[2.2.1]heptane |
| SMILES | Cc1ccc(S(=O)(=O)N2C[C@@H]3C[C@H]2C[P@]3c2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C22H22NO2PS/c1-16-9-11-20(12-10-16)27(24,25)23-14-19-13-18(23)15-26(19)22-8-4-6-17-5-2-3-7-21(17)22/h2-12,18-19H,13-15H2,1H3/t18-,19-,26-/m0/s1 |
| InChIKey | RGHUOMJULXTHPX-DGUDUIIESA-N |
| XLogP | 4.10 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|