C38H35ClN2O5S2 — CID 137465688
(4aR,8aS)-1-(4-chlorophenyl)sulfonyl-2-(4-methylphenyl)-6-(4-methylphenyl)sulfonyl-7-naphthalen-1-yl-3,4a,5,7,8,8a-hexahydro-2H-1,6-naphthyridin-4-one (PubChem CID 137465688) has the molecular formula C38H35ClN2O5S2 and a molecular weight of 699.29 g/mol. Its IUPAC name is (4aR,8aS)-1-(4-chlorophenyl)sulfonyl-2-(4-methylphenyl)-6-(4-methylphenyl)sulfonyl-7-naphthalen-1-yl-3,4a,5,7,8,8a-hexahydro-2H-1,6-naphthyridin-4-one.
| Compound Name | (4aR,8aS)-1-(4-chlorophenyl)sulfonyl-2-(4-methylphenyl)-6-(4-methylphenyl)sulfonyl-7-naphthalen-1-yl-3,4a,5,7,8,8a-hexahydro-2H-1,6-naphthyridin-4-one |
|---|---|
| PubChem CID | 137465688 |
| Molecular Formula | C38H35ClN2O5S2 |
| Molecular Weight | 699.29 g/mol |
| Exact Mass | 698.17 |
| IUPAC Name | (4aR,8aS)-1-(4-chlorophenyl)sulfonyl-2-(4-methylphenyl)-6-(4-methylphenyl)sulfonyl-7-naphthalen-1-yl-3,4a,5,7,8,8a-hexahydro-2H-1,6-naphthyridin-4-one |
| SMILES | Cc1ccc(C2CC(=O)[C@@H]3CN(S(=O)(=O)c4ccc(C)cc4)C(c4cccc5ccccc45)C[C@@H]3N2S(=O)(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C38H35ClN2O5S2/c1-25-10-14-28(15-11-25)35-23-38(42)34-24-40(47(43,44)30-18-12-26(2)13-19-30)36(33-9-5-7-27-6-3-4-8-32(27)33)22-37(34)41(35)48(45,46)31-20-16-29(39)17-21-31/h3-21,34-37H,22-24H2,1-2H3/t34-,35?,36?,37+/m1/s1 |
| InChIKey | SQCURWGBSCJMHJ-VBPBIINZSA-N |
| XLogP | 7.64 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.29 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |