C36H37FN2O5S2 — CID 137465584
(4aR,8aS)-7-(4-ethylphenyl)-2-(2-fluorophenyl)-1,6-bis-(4-methylphenyl)sulfonyl-3,4a,5,7,8,8a-hexahydro-2H-1,6-naphthyridin-4-one (PubChem CID 137465584) has the molecular formula C36H37FN2O5S2 and a molecular weight of 660.83 g/mol. Its IUPAC name is (4aR,8aS)-7-(4-ethylphenyl)-2-(2-fluorophenyl)-1,6-bis-(4-methylphenyl)sulfonyl-3,4a,5,7,8,8a-hexahydro-2H-1,6-naphthyridin-4-one.
| Compound Name | (4aR,8aS)-7-(4-ethylphenyl)-2-(2-fluorophenyl)-1,6-bis-(4-methylphenyl)sulfonyl-3,4a,5,7,8,8a-hexahydro-2H-1,6-naphthyridin-4-one |
|---|---|
| PubChem CID | 137465584 |
| Molecular Formula | C36H37FN2O5S2 |
| Molecular Weight | 660.83 g/mol |
| Exact Mass | 660.21 |
| IUPAC Name | (4aR,8aS)-7-(4-ethylphenyl)-2-(2-fluorophenyl)-1,6-bis-(4-methylphenyl)sulfonyl-3,4a,5,7,8,8a-hexahydro-2H-1,6-naphthyridin-4-one |
| SMILES | CCc1ccc(C2C[C@H]3[C@@H](CN2S(=O)(=O)c2ccc(C)cc2)C(=O)CC(c2ccccc2F)N3S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C36H37FN2O5S2/c1-4-26-13-15-27(16-14-26)33-21-34-31(23-38(33)45(41,42)28-17-9-24(2)10-18-28)36(40)22-35(30-7-5-6-8-32(30)37)39(34)46(43,44)29-19-11-25(3)12-20-29/h5-20,31,33-35H,4,21-23H2,1-3H3/t31-,33?,34+,35?/m1/s1 |
| InChIKey | ZGEINQAZVKELGY-XTLNHBQGSA-N |
| XLogP | 6.53 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.83 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |