C33H31BrN2O5S2 — CID 51359275
(2S,4aR,7S,8aS)-1-(4-bromophenyl)sulfonyl-6-(4-methylphenyl)sulfonyl-2,7-diphenyl-3,4a,5,7,8,8a-hexahydro-2H-1,6-naphthyridin-4-one (PubChem CID 51359275) has the molecular formula C33H31BrN2O5S2 and a molecular weight of 679.66 g/mol. Its IUPAC name is (2S,4aR,7S,8aS)-1-(4-bromophenyl)sulfonyl-6-(4-methylphenyl)sulfonyl-2,7-diphenyl-3,4a,5,7,8,8a-hexahydro-2H-1,6-naphthyridin-4-one.
| Compound Name | (2S,4aR,7S,8aS)-1-(4-bromophenyl)sulfonyl-6-(4-methylphenyl)sulfonyl-2,7-diphenyl-3,4a,5,7,8,8a-hexahydro-2H-1,6-naphthyridin-4-one |
|---|---|
| PubChem CID | 51359275 |
| Molecular Formula | C33H31BrN2O5S2 |
| Molecular Weight | 679.66 g/mol |
| Exact Mass | 678.09 |
| IUPAC Name | (2S,4aR,7S,8aS)-1-(4-bromophenyl)sulfonyl-6-(4-methylphenyl)sulfonyl-2,7-diphenyl-3,4a,5,7,8,8a-hexahydro-2H-1,6-naphthyridin-4-one |
| SMILES | Cc1ccc(S(=O)(=O)N2C[C@H]3C(=O)C[C@@H](c4ccccc4)N(S(=O)(=O)c4ccc(Br)cc4)[C@H]3C[C@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C33H31BrN2O5S2/c1-23-12-16-27(17-13-23)42(38,39)35-22-29-32(20-30(35)24-8-4-2-5-9-24)36(43(40,41)28-18-14-26(34)15-19-28)31(21-33(29)37)25-10-6-3-7-11-25/h2-19,29-32H,20-22H2,1H3/t29-,30+,31+,32+/m1/s1 |
| InChIKey | UTNFBYOBOWHJBS-ZLESDFJESA-N |
| XLogP | 6.28 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.66 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |