C36H34N2O4S2 — CID 134953521
(2R,3R,5S)-1,4-bis-(4-methylphenyl)sulfonyl-2,3,5-triphenylpiperazine (PubChem CID 134953521) has the molecular formula C36H34N2O4S2 and a molecular weight of 622.81 g/mol. Its IUPAC name is (2R,3R,5S)-1,4-bis-(4-methylphenyl)sulfonyl-2,3,5-triphenylpiperazine.
| Compound Name | (2R,3R,5S)-1,4-bis-(4-methylphenyl)sulfonyl-2,3,5-triphenylpiperazine |
|---|---|
| PubChem CID | 134953521 |
| Molecular Formula | C36H34N2O4S2 |
| Molecular Weight | 622.81 g/mol |
| Exact Mass | 622.20 |
| IUPAC Name | (2R,3R,5S)-1,4-bis-(4-methylphenyl)sulfonyl-2,3,5-triphenylpiperazine |
| SMILES | Cc1ccc(S(=O)(=O)N2C[C@H](c3ccccc3)N(S(=O)(=O)c3ccc(C)cc3)[C@H](c3ccccc3)[C@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C36H34N2O4S2/c1-27-18-22-32(23-19-27)43(39,40)37-26-34(29-12-6-3-7-13-29)38(44(41,42)33-24-20-28(2)21-25-33)36(31-16-10-5-11-17-31)35(37)30-14-8-4-9-15-30/h3-25,34-36H,26H2,1-2H3/t34-,35-,36-/m1/s1 |
| InChIKey | ARCIXFQWADVYLD-KUFDTJSHSA-N |
| XLogP | 7.22 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.81 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |