C26H39NO2SSi — CID 11167017
[(3S,5S)-1-(4-methylphenyl)sulfonyl-5-phenylpyrrolidin-3-yl]-tri(propan-2-yl)silane (PubChem CID 11167017) has the molecular formula C26H39NO2SSi and a molecular weight of 457.76 g/mol. Its IUPAC name is [(3S,5S)-1-(4-methylphenyl)sulfonyl-5-phenylpyrrolidin-3-yl]-tri(propan-2-yl)silane.
| Compound Name | [(3S,5S)-1-(4-methylphenyl)sulfonyl-5-phenylpyrrolidin-3-yl]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 11167017 |
| Molecular Formula | C26H39NO2SSi |
| Molecular Weight | 457.76 g/mol |
| Exact Mass | 457.25 |
| IUPAC Name | [(3S,5S)-1-(4-methylphenyl)sulfonyl-5-phenylpyrrolidin-3-yl]-tri(propan-2-yl)silane |
| SMILES | Cc1ccc(S(=O)(=O)N2C[C@@H]([Si](C(C)C)(C(C)C)C(C)C)C[C@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C26H39NO2SSi/c1-19(2)31(20(3)4,21(5)6)25-17-26(23-11-9-8-10-12-23)27(18-25)30(28,29)24-15-13-22(7)14-16-24/h8-16,19-21,25-26H,17-18H2,1-7H3/t25-,26-/m0/s1 |
| InChIKey | QZMMEHPMFABDCZ-UIOOFZCWSA-N |
| XLogP | 7.18 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.76 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|