C24H23NO2S — CID 131848674
(2R,3S)-4-methylidene-1-(4-methylphenyl)sulfonyl-2,3-diphenylpyrrolidine (PubChem CID 131848674) has the molecular formula C24H23NO2S and a molecular weight of 389.52 g/mol. Its IUPAC name is (2R,3S)-4-methylidene-1-(4-methylphenyl)sulfonyl-2,3-diphenylpyrrolidine.
| Compound Name | (2R,3S)-4-methylidene-1-(4-methylphenyl)sulfonyl-2,3-diphenylpyrrolidine |
|---|---|
| PubChem CID | 131848674 |
| Molecular Formula | C24H23NO2S |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | (2R,3S)-4-methylidene-1-(4-methylphenyl)sulfonyl-2,3-diphenylpyrrolidine |
| SMILES | C=C1CN(S(=O)(=O)c2ccc(C)cc2)[C@@H](c2ccccc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C24H23NO2S/c1-18-13-15-22(16-14-18)28(26,27)25-17-19(2)23(20-9-5-3-6-10-20)24(25)21-11-7-4-8-12-21/h3-16,23-24H,2,17H2,1H3/t23-,24+/m1/s1 |
| InChIKey | YEFHUCYAKNBRJR-RPWUZVMVSA-N |
| XLogP | 5.08 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|