C35H36N2O6S2 — CID 140958121
(2S,4aR,7S,8aS)-1-(benzenesulfonyl)-2-(4-methoxyphenyl)-7-(4-methylphenyl)-6-(4-methylphenyl)sulfonyl-3,4a,5,7,8,8a-hexahydro-2H-1,6-naphthyridin-4-one (PubChem CID 140958121) has the molecular formula C35H36N2O6S2 and a molecular weight of 644.82 g/mol. Its IUPAC name is (2S,4aR,7S,8aS)-1-(benzenesulfonyl)-2-(4-methoxyphenyl)-7-(4-methylphenyl)-6-(4-methylphenyl)sulfonyl-3,4a,5,7,8,8a-hexahydro-2H-1,6-naphthyridin-4-one.
| Compound Name | (2S,4aR,7S,8aS)-1-(benzenesulfonyl)-2-(4-methoxyphenyl)-7-(4-methylphenyl)-6-(4-methylphenyl)sulfonyl-3,4a,5,7,8,8a-hexahydro-2H-1,6-naphthyridin-4-one |
|---|---|
| PubChem CID | 140958121 |
| Molecular Formula | C35H36N2O6S2 |
| Molecular Weight | 644.82 g/mol |
| Exact Mass | 644.20 |
| IUPAC Name | (2S,4aR,7S,8aS)-1-(benzenesulfonyl)-2-(4-methoxyphenyl)-7-(4-methylphenyl)-6-(4-methylphenyl)sulfonyl-3,4a,5,7,8,8a-hexahydro-2H-1,6-naphthyridin-4-one |
| SMILES | COc1ccc([C@@H]2CC(=O)[C@@H]3CN(S(=O)(=O)c4ccc(C)cc4)[C@H](c4ccc(C)cc4)C[C@@H]3N2S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C35H36N2O6S2/c1-24-9-13-26(14-10-24)32-21-34-31(23-36(32)44(39,40)30-19-11-25(2)12-20-30)35(38)22-33(27-15-17-28(43-3)18-16-27)37(34)45(41,42)29-7-5-4-6-8-29/h4-20,31-34H,21-23H2,1-3H3/t31-,32+,33+,34+/m1/s1 |
| InChIKey | BXMYXPRBAHMIDV-WNQXLSPZSA-N |
| XLogP | 5.84 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.82 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |