C38H44N2O5S2 — CID 53384242
(2S,4S)-2,7-bis(4-ethylphenyl)-1,6-bis-(4-methylphenyl)sulfonyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-4-ol (PubChem CID 53384242) has the molecular formula C38H44N2O5S2 and a molecular weight of 672.91 g/mol. Its IUPAC name is (2S,4S)-2,7-bis(4-ethylphenyl)-1,6-bis-(4-methylphenyl)sulfonyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-4-ol.
| Compound Name | (2S,4S)-2,7-bis(4-ethylphenyl)-1,6-bis-(4-methylphenyl)sulfonyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-4-ol |
|---|---|
| PubChem CID | 53384242 |
| Molecular Formula | C38H44N2O5S2 |
| Molecular Weight | 672.91 g/mol |
| Exact Mass | 672.27 |
| IUPAC Name | (2S,4S)-2,7-bis(4-ethylphenyl)-1,6-bis-(4-methylphenyl)sulfonyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridin-4-ol |
| SMILES | CCc1ccc(C2CC3C(CN2S(=O)(=O)c2ccc(C)cc2)[C@@H](O)C[C@@H](c2ccc(CC)cc2)N3S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C38H44N2O5S2/c1-5-28-11-15-30(16-12-28)35-23-37-34(25-39(35)46(42,43)32-19-7-26(3)8-20-32)38(41)24-36(31-17-13-29(6-2)14-18-31)40(37)47(44,45)33-21-9-27(4)10-22-33/h7-22,34-38,41H,5-6,23-25H2,1-4H3/t34?,35?,36-,37?,38-/m0/s1 |
| InChIKey | UKOZCNAIABRJTO-ODDDCXQASA-N |
| XLogP | 6.75 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.91 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |