C26H35NO4S2 — CID 155562069
(3S,4R,6S)-6-(4-ethylphenyl)-1-(4-methylphenyl)sulfonyl-4-pentylsulfanylpiperidine-3-carboxylic acid (PubChem CID 155562069) has the molecular formula C26H35NO4S2 and a molecular weight of 489.70 g/mol. Its IUPAC name is (3S,4R,6S)-6-(4-ethylphenyl)-1-(4-methylphenyl)sulfonyl-4-pentylsulfanylpiperidine-3-carboxylic acid.
| Compound Name | (3S,4R,6S)-6-(4-ethylphenyl)-1-(4-methylphenyl)sulfonyl-4-pentylsulfanylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 155562069 |
| Molecular Formula | C26H35NO4S2 |
| Molecular Weight | 489.70 g/mol |
| Exact Mass | 489.20 |
| IUPAC Name | (3S,4R,6S)-6-(4-ethylphenyl)-1-(4-methylphenyl)sulfonyl-4-pentylsulfanylpiperidine-3-carboxylic acid |
| SMILES | CCCCCS[C@@H]1C[C@@H](c2ccc(CC)cc2)N(S(=O)(=O)c2ccc(C)cc2)C[C@H]1C(=O)O |
| InChI | InChI=1S/C26H35NO4S2/c1-4-6-7-16-32-25-17-24(21-12-10-20(5-2)11-13-21)27(18-23(25)26(28)29)33(30,31)22-14-8-19(3)9-15-22/h8-15,23-25H,4-7,16-18H2,1-3H3,(H,28,29)/t23-,24+,25-/m1/s1 |
| InChIKey | JTXCZOCTJSKKNE-DSNGMDLFSA-N |
| XLogP | 5.69 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.70 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|