C26H35NO7S2 — CID 155565397
(3S,4R,6S)-4-butylsulfanyl-1-(4-methylphenyl)sulfonyl-6-(3,4,5-trimethoxyphenyl)piperidine-3-carboxylic acid (PubChem CID 155565397) has the molecular formula C26H35NO7S2 and a molecular weight of 537.70 g/mol. Its IUPAC name is (3S,4R,6S)-4-butylsulfanyl-1-(4-methylphenyl)sulfonyl-6-(3,4,5-trimethoxyphenyl)piperidine-3-carboxylic acid.
| Compound Name | (3S,4R,6S)-4-butylsulfanyl-1-(4-methylphenyl)sulfonyl-6-(3,4,5-trimethoxyphenyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 155565397 |
| Molecular Formula | C26H35NO7S2 |
| Molecular Weight | 537.70 g/mol |
| Exact Mass | 537.19 |
| IUPAC Name | (3S,4R,6S)-4-butylsulfanyl-1-(4-methylphenyl)sulfonyl-6-(3,4,5-trimethoxyphenyl)piperidine-3-carboxylic acid |
| SMILES | CCCCS[C@@H]1C[C@@H](c2cc(OC)c(OC)c(OC)c2)N(S(=O)(=O)c2ccc(C)cc2)C[C@H]1C(=O)O |
| InChI | InChI=1S/C26H35NO7S2/c1-6-7-12-35-24-15-21(18-13-22(32-3)25(34-5)23(14-18)33-4)27(16-20(24)26(28)29)36(30,31)19-10-8-17(2)9-11-19/h8-11,13-14,20-21,24H,6-7,12,15-16H2,1-5H3,(H,28,29)/t20-,21+,24-/m1/s1 |
| InChIKey | ASAGYPDTFFRWGV-ZFGGDYGUSA-N |
| XLogP | 4.76 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.70 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|