C25H32ClNO4S2 — CID 155555266
(3S,4R,6S)-6-(3-chlorophenyl)-4-hexylsulfanyl-1-(4-methylphenyl)sulfonylpiperidine-3-carboxylic acid (PubChem CID 155555266) has the molecular formula C25H32ClNO4S2 and a molecular weight of 510.12 g/mol. Its IUPAC name is (3S,4R,6S)-6-(3-chlorophenyl)-4-hexylsulfanyl-1-(4-methylphenyl)sulfonylpiperidine-3-carboxylic acid.
| Compound Name | (3S,4R,6S)-6-(3-chlorophenyl)-4-hexylsulfanyl-1-(4-methylphenyl)sulfonylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 155555266 |
| Molecular Formula | C25H32ClNO4S2 |
| Molecular Weight | 510.12 g/mol |
| Exact Mass | 509.15 |
| IUPAC Name | (3S,4R,6S)-6-(3-chlorophenyl)-4-hexylsulfanyl-1-(4-methylphenyl)sulfonylpiperidine-3-carboxylic acid |
| SMILES | CCCCCCS[C@@H]1C[C@@H](c2cccc(Cl)c2)N(S(=O)(=O)c2ccc(C)cc2)C[C@H]1C(=O)O |
| InChI | InChI=1S/C25H32ClNO4S2/c1-3-4-5-6-14-32-24-16-23(19-8-7-9-20(26)15-19)27(17-22(24)25(28)29)33(30,31)21-12-10-18(2)11-13-21/h7-13,15,22-24H,3-6,14,16-17H2,1-2H3,(H,28,29)/t22-,23+,24-/m1/s1 |
| InChIKey | AEOOIYPBMWKKGC-TZRRMPRUSA-N |
| XLogP | 6.17 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.12 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|