C23H27NO4S2 — CID 16656620
(3S,4R,6S)-6-(4-methylphenyl)-1-(4-methylphenyl)sulfonyl-4-prop-2-enylsulfanylpiperidine-3-carboxylic acid (PubChem CID 16656620) has the molecular formula C23H27NO4S2 and a molecular weight of 445.61 g/mol. Its IUPAC name is (3S,4R,6S)-6-(4-methylphenyl)-1-(4-methylphenyl)sulfonyl-4-prop-2-enylsulfanylpiperidine-3-carboxylic acid.
| Compound Name | (3S,4R,6S)-6-(4-methylphenyl)-1-(4-methylphenyl)sulfonyl-4-prop-2-enylsulfanylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 16656620 |
| Molecular Formula | C23H27NO4S2 |
| Molecular Weight | 445.61 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | (3S,4R,6S)-6-(4-methylphenyl)-1-(4-methylphenyl)sulfonyl-4-prop-2-enylsulfanylpiperidine-3-carboxylic acid |
| SMILES | C=CCS[C@@H]1C[C@@H](c2ccc(C)cc2)N(S(=O)(=O)c2ccc(C)cc2)C[C@H]1C(=O)O |
| InChI | InChI=1S/C23H27NO4S2/c1-4-13-29-22-14-21(18-9-5-16(2)6-10-18)24(15-20(22)23(25)26)30(27,28)19-11-7-17(3)8-12-19/h4-12,20-22H,1,13-15H2,2-3H3,(H,25,26)/t20-,21+,22-/m1/s1 |
| InChIKey | YKTFFTHWAYAHTE-BHIFYINESA-N |
| XLogP | 4.43 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.61 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|