C25H33NO4S2 — CID 155558157
(3S,4R,6S)-4-hexylsulfanyl-1-(4-methylphenyl)sulfonyl-6-phenylpiperidine-3-carboxylic acid (PubChem CID 155558157) has the molecular formula C25H33NO4S2 and a molecular weight of 475.68 g/mol. Its IUPAC name is (3S,4R,6S)-4-hexylsulfanyl-1-(4-methylphenyl)sulfonyl-6-phenylpiperidine-3-carboxylic acid.
| Compound Name | (3S,4R,6S)-4-hexylsulfanyl-1-(4-methylphenyl)sulfonyl-6-phenylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 155558157 |
| Molecular Formula | C25H33NO4S2 |
| Molecular Weight | 475.68 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | (3S,4R,6S)-4-hexylsulfanyl-1-(4-methylphenyl)sulfonyl-6-phenylpiperidine-3-carboxylic acid |
| SMILES | CCCCCCS[C@@H]1C[C@@H](c2ccccc2)N(S(=O)(=O)c2ccc(C)cc2)C[C@H]1C(=O)O |
| InChI | InChI=1S/C25H33NO4S2/c1-3-4-5-9-16-31-24-17-23(20-10-7-6-8-11-20)26(18-22(24)25(27)28)32(29,30)21-14-12-19(2)13-15-21/h6-8,10-15,22-24H,3-5,9,16-18H2,1-2H3,(H,27,28)/t22-,23+,24-/m1/s1 |
| InChIKey | UEAHNZKIHHWIJT-TZRRMPRUSA-N |
| XLogP | 5.51 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.68 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|