C23H25NO6S2 — CID 155548596
(3S,4R,6S)-6-(1,3-benzodioxol-5-yl)-1-(4-methylphenyl)sulfonyl-4-prop-2-enylsulfanylpiperidine-3-carboxylic acid (PubChem CID 155548596) has the molecular formula C23H25NO6S2 and a molecular weight of 475.59 g/mol. Its IUPAC name is (3S,4R,6S)-6-(1,3-benzodioxol-5-yl)-1-(4-methylphenyl)sulfonyl-4-prop-2-enylsulfanylpiperidine-3-carboxylic acid.
| Compound Name | (3S,4R,6S)-6-(1,3-benzodioxol-5-yl)-1-(4-methylphenyl)sulfonyl-4-prop-2-enylsulfanylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 155548596 |
| Molecular Formula | C23H25NO6S2 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.11 |
| IUPAC Name | (3S,4R,6S)-6-(1,3-benzodioxol-5-yl)-1-(4-methylphenyl)sulfonyl-4-prop-2-enylsulfanylpiperidine-3-carboxylic acid |
| SMILES | C=CCS[C@@H]1C[C@@H](c2ccc3c(c2)OCO3)N(S(=O)(=O)c2ccc(C)cc2)C[C@H]1C(=O)O |
| InChI | InChI=1S/C23H25NO6S2/c1-3-10-31-22-12-19(16-6-9-20-21(11-16)30-14-29-20)24(13-18(22)23(25)26)32(27,28)17-7-4-15(2)5-8-17/h3-9,11,18-19,22H,1,10,12-14H2,2H3,(H,25,26)/t18-,19+,22-/m1/s1 |
| InChIKey | QUPMNOKYZMOZMF-XQBPLPMBSA-N |
| XLogP | 3.85 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|