C26H38N2O4S2 — CID 162409644
(2S,5S)-1,4-bis-(4-methylphenyl)sulfonyl-2,5-bis(2-methylpropyl)piperazine (PubChem CID 162409644) has the molecular formula C26H38N2O4S2 and a molecular weight of 506.73 g/mol. Its IUPAC name is (2S,5S)-1,4-bis-(4-methylphenyl)sulfonyl-2,5-bis(2-methylpropyl)piperazine.
| Compound Name | (2S,5S)-1,4-bis-(4-methylphenyl)sulfonyl-2,5-bis(2-methylpropyl)piperazine |
|---|---|
| PubChem CID | 162409644 |
| Molecular Formula | C26H38N2O4S2 |
| Molecular Weight | 506.73 g/mol |
| Exact Mass | 506.23 |
| IUPAC Name | (2S,5S)-1,4-bis-(4-methylphenyl)sulfonyl-2,5-bis(2-methylpropyl)piperazine |
| SMILES | Cc1ccc(S(=O)(=O)N2C[C@H](CC(C)C)N(S(=O)(=O)c3ccc(C)cc3)C[C@@H]2CC(C)C)cc1 |
| InChI | InChI=1S/C26H38N2O4S2/c1-19(2)15-23-17-28(34(31,32)26-13-9-22(6)10-14-26)24(16-20(3)4)18-27(23)33(29,30)25-11-7-21(5)8-12-25/h7-14,19-20,23-24H,15-18H2,1-6H3/t23-,24-/m0/s1 |
| InChIKey | SBQJOFYCBZWACL-ZEQRLZLVSA-N |
| XLogP | 4.83 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.73 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |