C13H17NO2S — CID 102594700
(2R)-2-but-3-enyl-1-(4-methylphenyl)sulfonylaziridine (PubChem CID 102594700) has the molecular formula C13H17NO2S and a molecular weight of 251.35 g/mol. Its IUPAC name is (2R)-2-but-3-enyl-1-(4-methylphenyl)sulfonylaziridine.
| Compound Name | (2R)-2-but-3-enyl-1-(4-methylphenyl)sulfonylaziridine |
|---|---|
| PubChem CID | 102594700 |
| Molecular Formula | C13H17NO2S |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | (2R)-2-but-3-enyl-1-(4-methylphenyl)sulfonylaziridine |
| SMILES | C=CCC[C@@H]1CN1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C13H17NO2S/c1-3-4-5-12-10-14(12)17(15,16)13-8-6-11(2)7-9-13/h3,6-9,12H,1,4-5,10H2,2H3/t12-,14?/m1/s1 |
| InChIKey | YFFHJCIAECCHME-PUODRLBUSA-N |
| XLogP | 2.33 |
| TPSA | 37.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|