C17H23NO4S — CID 11290674
ethyl (Z)-6-[1-(4-methylphenyl)sulfonylaziridin-2-yl]hex-2-enoate (PubChem CID 11290674) has the molecular formula C17H23NO4S and a molecular weight of 337.44 g/mol. Its IUPAC name is ethyl (Z)-6-[1-(4-methylphenyl)sulfonylaziridin-2-yl]hex-2-enoate.
| Compound Name | ethyl (Z)-6-[1-(4-methylphenyl)sulfonylaziridin-2-yl]hex-2-enoate |
|---|---|
| PubChem CID | 11290674 |
| Molecular Formula | C17H23NO4S |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | ethyl (Z)-6-[1-(4-methylphenyl)sulfonylaziridin-2-yl]hex-2-enoate |
| SMILES | CCOC(=O)/C=C\CCCC1CN1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C17H23NO4S/c1-3-22-17(19)8-6-4-5-7-15-13-18(15)23(20,21)16-11-9-14(2)10-12-16/h6,8-12,15H,3-5,7,13H2,1-2H3/b8-6- |
| InChIKey | MZPXBRDJVCYKDT-VURMDHGXSA-N |
| XLogP | 2.66 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|