C25H28FNO6S — CID 163207106
diethyl 2-[[4-fluoro-2-[2-[1-(4-methylphenyl)sulfonylaziridin-2-yl]ethyl]phenyl]methylidene]propanedioate (PubChem CID 163207106) has the molecular formula C25H28FNO6S and a molecular weight of 489.57 g/mol. Its IUPAC name is diethyl 2-[[4-fluoro-2-[2-[1-(4-methylphenyl)sulfonylaziridin-2-yl]ethyl]phenyl]methylidene]propanedioate.
| Compound Name | diethyl 2-[[4-fluoro-2-[2-[1-(4-methylphenyl)sulfonylaziridin-2-yl]ethyl]phenyl]methylidene]propanedioate |
|---|---|
| PubChem CID | 163207106 |
| Molecular Formula | C25H28FNO6S |
| Molecular Weight | 489.57 g/mol |
| Exact Mass | 489.16 |
| IUPAC Name | diethyl 2-[[4-fluoro-2-[2-[1-(4-methylphenyl)sulfonylaziridin-2-yl]ethyl]phenyl]methylidene]propanedioate |
| SMILES | CCOC(=O)C(=Cc1ccc(F)cc1CCC1CN1S(=O)(=O)c1ccc(C)cc1)C(=O)OCC |
| InChI | InChI=1S/C25H28FNO6S/c1-4-32-24(28)23(25(29)33-5-2)15-19-8-10-20(26)14-18(19)9-11-21-16-27(21)34(30,31)22-12-6-17(3)7-13-22/h6-8,10,12-15,21H,4-5,9,11,16H2,1-3H3 |
| InChIKey | HRIHDVINFGSEOT-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.57 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|