C19H31NO2S — CID 157340233
2-butyl-1-(4-methylphenyl)sulfonylaziridine;hex-1-ene (PubChem CID 157340233) has the molecular formula C19H31NO2S and a molecular weight of 337.53 g/mol. Its IUPAC name is 2-butyl-1-(4-methylphenyl)sulfonylaziridine;hex-1-ene.
| Compound Name | 2-butyl-1-(4-methylphenyl)sulfonylaziridine;hex-1-ene |
|---|---|
| PubChem CID | 157340233 |
| Molecular Formula | C19H31NO2S |
| Molecular Weight | 337.53 g/mol |
| Exact Mass | 337.21 |
| IUPAC Name | 2-butyl-1-(4-methylphenyl)sulfonylaziridine;hex-1-ene |
| SMILES | C=CCCCC.CCCCC1CN1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C13H19NO2S.C6H12/c1-3-4-5-12-10-14(12)17(15,16)13-8-6-11(2)7-9-13;1-3-5-6-4-2/h6-9,12H,3-5,10H2,1-2H3;3H,1,4-6H2,2H3 |
| InChIKey | BGHRQVHBIRDKIM-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 37.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.53 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|