C15H19NO2S — CID 100926221
(2R,3R)-2-ethynyl-1-(4-methylphenyl)sulfonyl-3-(2-methylpropyl)aziridine (PubChem CID 100926221) has the molecular formula C15H19NO2S and a molecular weight of 277.39 g/mol. Its IUPAC name is (2R,3R)-2-ethynyl-1-(4-methylphenyl)sulfonyl-3-(2-methylpropyl)aziridine.
| Compound Name | (2R,3R)-2-ethynyl-1-(4-methylphenyl)sulfonyl-3-(2-methylpropyl)aziridine |
|---|---|
| PubChem CID | 100926221 |
| Molecular Formula | C15H19NO2S |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | (2R,3R)-2-ethynyl-1-(4-methylphenyl)sulfonyl-3-(2-methylpropyl)aziridine |
| SMILES | C#C[C@@H]1[C@@H](CC(C)C)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C15H19NO2S/c1-5-14-15(10-11(2)3)16(14)19(17,18)13-8-6-12(4)7-9-13/h1,6-9,11,14-15H,10H2,2-4H3/t14-,15-,16?/m1/s1 |
| InChIKey | JJCWDFPSPVOCAD-YGFGXBMJSA-N |
| XLogP | 2.42 |
| TPSA | 37.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|