C16H23NO3S — CID 134833469
2-[(2S,5R)-1-(4-methylphenyl)sulfonyl-5-propan-2-ylpyrrolidin-2-yl]acetaldehyde (PubChem CID 134833469) has the molecular formula C16H23NO3S and a molecular weight of 309.43 g/mol. Its IUPAC name is 2-[(2S,5R)-1-(4-methylphenyl)sulfonyl-5-propan-2-ylpyrrolidin-2-yl]acetaldehyde.
| Compound Name | 2-[(2S,5R)-1-(4-methylphenyl)sulfonyl-5-propan-2-ylpyrrolidin-2-yl]acetaldehyde |
|---|---|
| PubChem CID | 134833469 |
| Molecular Formula | C16H23NO3S |
| Molecular Weight | 309.43 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | 2-[(2S,5R)-1-(4-methylphenyl)sulfonyl-5-propan-2-ylpyrrolidin-2-yl]acetaldehyde |
| SMILES | Cc1ccc(S(=O)(=O)N2[C@H](CC=O)CC[C@@H]2C(C)C)cc1 |
| InChI | InChI=1S/C16H23NO3S/c1-12(2)16-9-6-14(10-11-18)17(16)21(19,20)15-7-4-13(3)5-8-15/h4-5,7-8,11-12,14,16H,6,9-10H2,1-3H3/t14-,16+/m0/s1 |
| InChIKey | JXDREILUOSQBSD-GOEBONIOSA-N |
| XLogP | 2.76 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.43 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|