C18H25NO3S3 — CID 51051105
2-[(8R,10S)-8-methyl-9-(4-methylphenyl)sulfonyl-1,5-dithia-9-azaspiro[5.5]undecan-10-yl]acetaldehyde (PubChem CID 51051105) has the molecular formula C18H25NO3S3 and a molecular weight of 399.60 g/mol. Its IUPAC name is 2-[(8R,10S)-8-methyl-9-(4-methylphenyl)sulfonyl-1,5-dithia-9-azaspiro[5.5]undecan-10-yl]acetaldehyde.
| Compound Name | 2-[(8R,10S)-8-methyl-9-(4-methylphenyl)sulfonyl-1,5-dithia-9-azaspiro[5.5]undecan-10-yl]acetaldehyde |
|---|---|
| PubChem CID | 51051105 |
| Molecular Formula | C18H25NO3S3 |
| Molecular Weight | 399.60 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | 2-[(8R,10S)-8-methyl-9-(4-methylphenyl)sulfonyl-1,5-dithia-9-azaspiro[5.5]undecan-10-yl]acetaldehyde |
| SMILES | Cc1ccc(S(=O)(=O)N2[C@@H](CC=O)CC3(C[C@H]2C)SCCCS3)cc1 |
| InChI | InChI=1S/C18H25NO3S3/c1-14-4-6-17(7-5-14)25(21,22)19-15(2)12-18(13-16(19)8-9-20)23-10-3-11-24-18/h4-7,9,15-16H,3,8,10-13H2,1-2H3/t15-,16+/m1/s1 |
| InChIKey | ACQMZGXFMRWLJG-CVEARBPZSA-N |
| XLogP | 3.69 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.60 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|