C17H23NO3S — CID 10980184
(1R,2R,3R,4S,6S)-3-methyl-10-(4-methylphenyl)sulfonyl-10-azatricyclo[4.3.1.02,4]decan-4-ol (PubChem CID 10980184) has the molecular formula C17H23NO3S and a molecular weight of 321.44 g/mol. Its IUPAC name is (1R,2R,3R,4S,6S)-3-methyl-10-(4-methylphenyl)sulfonyl-10-azatricyclo[4.3.1.02,4]decan-4-ol.
| Compound Name | (1R,2R,3R,4S,6S)-3-methyl-10-(4-methylphenyl)sulfonyl-10-azatricyclo[4.3.1.02,4]decan-4-ol |
|---|---|
| PubChem CID | 10980184 |
| Molecular Formula | C17H23NO3S |
| Molecular Weight | 321.44 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | (1R,2R,3R,4S,6S)-3-methyl-10-(4-methylphenyl)sulfonyl-10-azatricyclo[4.3.1.02,4]decan-4-ol |
| SMILES | Cc1ccc(S(=O)(=O)N2[C@H]3CCC[C@@H]2[C@H]2[C@@H](C)[C@@]2(O)C3)cc1 |
| InChI | InChI=1S/C17H23NO3S/c1-11-6-8-14(9-7-11)22(20,21)18-13-4-3-5-15(18)16-12(2)17(16,19)10-13/h6-9,12-13,15-16,19H,3-5,10H2,1-2H3/t12-,13+,15-,16-,17+/m1/s1 |
| InChIKey | YTIHTZUBCCAWIB-IEHFGQBSSA-N |
| XLogP | 2.31 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.44 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |